Tricyclo[8.4.2.24,7]octadeca-4,5,6-triene
Modify Date: 2024-01-11 11:58:12
![Tricyclo[8.4.2.24,7]octadeca-4,5,6-triene Structure](https://image.chemsrc.com/caspic/225/84954-88-1.png)
Tricyclo[8.4.2.24,7]octadeca-4,5,6-triene structure
|
Common Name | Tricyclo[8.4.2.24,7]octadeca-4,5,6-triene | ||
|---|---|---|---|---|
| CAS Number | 84954-88-1 | Molecular Weight | 234.33600 | |
| Density | 1.05g/cm3 | Boiling Point | 423.3ºC at 760mmHg | |
| Molecular Formula | C18H18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.7ºC | |
| Name | Tricyclo[8.4.2.24,7]octadeca-4,5,6-triene |
|---|
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 423.3ºC at 760mmHg |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.33600 |
| Flash Point | 213.7ºC |
| Exact Mass | 234.14100 |
| LogP | 4.54420 |
| Index of Refraction | 1.614 |
| InChIKey | VRGLNGRQXLSACG-NWINMWQCSA-N |
| SMILES | C1=CC2=CC=C(C=C1)CCc1ccc(cc1)CC2 |
|
~66%
Tricyclo[8.4.2.... CAS#:84954-88-1 |
| Literature: Garbe; Boekelheide Journal of the American Chemical Society, 1983 , vol. 105, # 25 p. 7384 - 7388 |
