1H-Thiopyrano[2',3':4,5]thiopyrano[3,2-c][2,1]benzothiazin-1-one,2,3,6,12-tetrahydro-6-methyl-, 5,5-dioxide structure
|
Common Name | 1H-Thiopyrano[2',3':4,5]thiopyrano[3,2-c][2,1]benzothiazin-1-one,2,3,6,12-tetrahydro-6-methyl-, 5,5-dioxide | ||
|---|---|---|---|---|
| CAS Number | 84965-40-2 | Molecular Weight | 351.46400 | |
| Density | 1.61g/cm3 | Boiling Point | 526.5ºC at 760mmHg | |
| Molecular Formula | C15H13NO3S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.2ºC | |
| Name | 6-methyl-1-oxo-2,3-dihydro-1H,6H,12H-thiopyrano<3,2-c>thiopyrano<3,2-c><2,1>benzothiazine 5,5-dioxide |
|---|
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 526.5ºC at 760mmHg |
| Molecular Formula | C15H13NO3S3 |
| Molecular Weight | 351.46400 |
| Flash Point | 272.2ºC |
| Exact Mass | 351.00600 |
| PSA | 113.43000 |
| LogP | 3.98750 |
| Index of Refraction | 1.764 |
| InChIKey | KXYYMLPHKFRBIK-UHFFFAOYSA-N |
| SMILES | CN1c2ccccc2C2=C(C3=C(CS2)C(=O)CCS3)S1(=O)=O |
|
~31%
1H-Thiopyrano[2... CAS#:84965-40-2 |
| Literature: Cecchetti; Fravolini; Schiaffella Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 5 p. 1045 - 1050 |
|
~8%
1H-Thiopyrano[2... CAS#:84965-40-2
Detail
|
| Literature: Cecchetti; Fravolini; Schiaffella Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 5 p. 1045 - 1050 |
|
~%
1H-Thiopyrano[2... CAS#:84965-40-2 |
| Literature: Cecchetti; Fravolini; Schiaffella Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 5 p. 1045 - 1050 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |