4-[2-(dimethylamino)-1,3-thiazol-4-yl]benzoic acid structure
|
Common Name | 4-[2-(dimethylamino)-1,3-thiazol-4-yl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 849682-29-7 | Molecular Weight | 248.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(dimethylamino)-1,3-thiazol-4-yl]benzoic acid |
|---|
| Molecular Formula | C12H12N2O2S |
|---|---|
| Molecular Weight | 248.30100 |
| Exact Mass | 248.06200 |
| PSA | 81.67000 |
| LogP | 2.57430 |
| InChIKey | ZMAMINNUKWGLEN-UHFFFAOYSA-N |
| SMILES | CN(C)c1nc(-c2ccc(C(=O)O)cc2)cs1 |
|
~%
4-[2-(dimethyla... CAS#:849682-29-7 |
| Literature: Setti, Eduardo L.; Davis, Dana; Janc, James W.; Jeffery, Douglas A.; Cheung, Harry; Yu, Walter Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 5 p. 1529 - 1534 |
|
~%
4-[2-(dimethyla... CAS#:849682-29-7 |
| Literature: Setti, Eduardo L.; Davis, Dana; Janc, James W.; Jeffery, Douglas A.; Cheung, Harry; Yu, Walter Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 5 p. 1529 - 1534 |