Trans-4-Ethyl-(1,1-Bicyclohexyl)-4-Carboxylic Acid structure
|
Common Name | Trans-4-Ethyl-(1,1-Bicyclohexyl)-4-Carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 84976-67-0 | Molecular Weight | 238.36600 | |
| Density | 1.008±0.06 g/cm3 | Boiling Point | 355.8±10.0 °C | |
| Molecular Formula | C15H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Trans-4-Ethyl-(1,1-Bicyclohexyl)-4-Carboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.008±0.06 g/cm3 |
|---|---|
| Boiling Point | 355.8±10.0 °C |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.36600 |
| Exact Mass | 238.19300 |
| PSA | 37.30000 |
| LogP | 4.09380 |
| Index of Refraction | 1.497 |
| InChIKey | OQIHEFMTIUJJET-UHFFFAOYSA-N |
| SMILES | CCC1CCC(C2CCC(C(=O)O)CC2)CC1 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylic acid |