5-methoxy EiPT structure
|
Common Name | 5-methoxy EiPT | ||
|---|---|---|---|---|
| CAS Number | 850032-66-5 | Molecular Weight | 260.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-methoxy EiPT5-methoxy EiPT is a tryptamine-based designer drug with structural similarity to 5-methoxy DiPT and 5-methoxy MiPT |
| Name | N-ethyl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]propan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H24N2O |
|---|---|
| Molecular Weight | 260.37500 |
| Exact Mass | 260.18900 |
| PSA | 28.26000 |
| LogP | 3.44930 |
| InChIKey | VVEQXDHSGNBFLZ-UHFFFAOYSA-N |
| SMILES | CCN(CCc1c[nH]c2ccc(OC)cc12)C(C)C |
| N-ethyl-N-isoprpyl-5-methoxy-tryptamine |