6-[methyl(phenylsulphonyl)amino]hexanoic acid, compound with 2,2'-iminodiethanol (1:1) structure
|
Common Name | 6-[methyl(phenylsulphonyl)amino]hexanoic acid, compound with 2,2'-iminodiethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 85005-99-8 | Molecular Weight | 390.49500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H30N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[benzenesulfonyl(methyl)amino]hexanoic acid,2-(2-hydroxyethylamino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H30N2O6S |
|---|---|
| Molecular Weight | 390.49500 |
| Exact Mass | 390.18200 |
| PSA | 135.55000 |
| LogP | 1.98440 |
| InChIKey | CTRJLVUGMVATJS-UHFFFAOYSA-N |
| SMILES | CN(CCCCCC(=O)O)S(=O)(=O)c1ccccc1.OCCNCCO |
| EINECS 285-029-9 |
| 6-(Methyl(phenylsulphonyl)amino)hexanoic acid,compound with 2,2'-iminodiethanol (1:1) |