2-diethoxyphosphoryl-1-(1H-indol-3-yl)ethanone structure
|
Common Name | 2-diethoxyphosphoryl-1-(1H-indol-3-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 850231-86-6 | Molecular Weight | 295.27100 | |
| Density | 1.25g/cm3 | Boiling Point | 483.909ºC at 760 mmHg | |
| Molecular Formula | C14H18NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.46ºC | |
| Name | 2-diethoxyphosphoryl-1-(1H-indol-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 483.909ºC at 760 mmHg |
| Molecular Formula | C14H18NO4P |
| Molecular Weight | 295.27100 |
| Flash Point | 246.46ºC |
| Exact Mass | 295.09700 |
| PSA | 78.20000 |
| LogP | 3.61670 |
| Index of Refraction | 1.569 |
| InChIKey | PGMJTAAMJLMNGE-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC(=O)c1c[nH]c2ccccc12)OCC |
| HS Code | 2931900090 |
|---|
|
~28%
2-diethoxyphosp... CAS#:850231-86-6 |
| Literature: Slaett, Johnny; Janosik, Tomasz; Wahlstroem, Niklas; Bergman, Jan Journal of Heterocyclic Chemistry, 2005 , vol. 42, # 1 p. 141 - 145 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| I10-1056 |
| diethyl 2-(1H-indol-3-yl)-2-oxoethylphosphonate |