methyl 3-iodo-1h-indole-6-carboxylate structure
|
Common Name | methyl 3-iodo-1h-indole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 850374-98-0 | Molecular Weight | 301.08000 | |
| Density | 1.86g/cm3 | Boiling Point | 408ºC at 760 mmHg | |
| Molecular Formula | C10H8INO2 | Melting Point | 150(dec.)ºC | |
| MSDS | N/A | Flash Point | 200.6ºC | |
| Name | methyl 3-iodo-1h-indole-6-carboxylate |
|---|
| Density | 1.86g/cm3 |
|---|---|
| Boiling Point | 408ºC at 760 mmHg |
| Melting Point | 150(dec.)ºC |
| Molecular Formula | C10H8INO2 |
| Molecular Weight | 301.08000 |
| Flash Point | 200.6ºC |
| Exact Mass | 300.96000 |
| PSA | 42.09000 |
| LogP | 2.55910 |
| Index of Refraction | 1.709 |
| InChIKey | WUFYFIRKVXAESN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(I)c[nH]c2c1 |
|
~91%
methyl 3-iodo-1... CAS#:850374-98-0 |
| Literature: Mothes, Celine; Lavielle, Solange; Karoyan, Philippe Journal of Organic Chemistry, 2008 , vol. 73, # 17 p. 6706 - 6710 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |