2',7'-Dibromospiro[cyclopropane-1,9'-fluorene]
Modify Date: 2025-09-19 14:31:26
![2',7'-Dibromospiro[cyclopropane-1,9'-fluorene] Structure](https://www.chemsrc.com/extcaspic/395/850784-70-2.png)
2',7'-Dibromospiro[cyclopropane-1,9'-fluorene] structure
|
Common Name | 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene] | ||
|---|---|---|---|---|
| CAS Number | 850784-70-2 | Molecular Weight | 350.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H10Br2 |
|---|---|
| Molecular Weight | 350.05 |
| InChIKey | KPSSVCFGVKYXIQ-UHFFFAOYSA-N |
| SMILES | Brc1ccc2c(c1)C1(CC1)c1cc(Br)ccc1-2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 850784-70-2? |
| A: Chinese name of 850784-70-2 is 850784-70-2. |
| Q: What is the molecular formula of 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene]? |
| A: Molecular formula of 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene] is C15H10Br2. |
| Q: What is the molecular weight of 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene]? |
| A: Molecular weight of 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene] is 350.05. |
| Q: What is the CAS number of 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene]? |
| A: CAS number of 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene] is 850784-70-2. |
| Q: What is the SMILES notation of 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene]? |
| A: SMILES notation of 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene] is Brc1ccc2c(c1)C1(CC1)c1cc(Br)ccc1-2. |
| Q: What is the English name of 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene]? |
| A: The English name of 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene] is 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene]. |
| Q: What is the InChIKey of 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene]? |
| A: InChIKey of 2',7'-Dibromospiro[cyclopropane-1,9'-fluorene] is KPSSVCFGVKYXIQ-UHFFFAOYSA-N. |