5-Fluoro-1-(4-fluorobenzyl)-2,4(1H,3H)-pyrimidinedione
Modify Date: 2026-07-01 17:02:23
5-Fluoro-1-(4-fluorobenzyl)-2,4(1H,3H)-pyrimidinedione structure
|
Common Name | 5-Fluoro-1-(4-fluorobenzyl)-2,4(1H,3H)-pyrimidinedione | ||
|---|---|---|---|---|
| CAS Number | 85093-32-9 | Molecular Weight | 238.19000 | |
| Density | 1.44g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H8F2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-Fluoro-1-(4-fluorobenzyl)-2,4(1H,3H)-pyrimidinedione |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Molecular Formula | C11H8F2N2O2 |
| Molecular Weight | 238.19000 |
| Exact Mass | 238.05500 |
| PSA | 55.12000 |
| LogP | 1.27540 |
| Index of Refraction | 1.588 |
| InChIKey | NRKLRLVHPYUIAT-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(F)cc2)cc1F |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1