ethyl 3-[2-bromo-4-(trifluoromethyl)phenyl]-2-cyanoacrylate structure
|
Common Name | ethyl 3-[2-bromo-4-(trifluoromethyl)phenyl]-2-cyanoacrylate | ||
|---|---|---|---|---|
| CAS Number | 85118-34-9 | Molecular Weight | 348.11500 | |
| Density | 1.538g/cm3 | Boiling Point | 366.2ºC at 760 mmHg | |
| Molecular Formula | C13H9BrF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | ethyl 3-[2-bromo-4-(trifluoromethyl)phenyl]-2-cyanoprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.538g/cm3 |
|---|---|
| Boiling Point | 366.2ºC at 760 mmHg |
| Molecular Formula | C13H9BrF3NO2 |
| Molecular Weight | 348.11500 |
| Flash Point | 175.3ºC |
| Exact Mass | 346.97700 |
| PSA | 50.09000 |
| LogP | 3.93798 |
| Index of Refraction | 1.533 |
| InChIKey | IQXGKIDXUFMKPE-WEVVVXLNSA-N |
| SMILES | CCOC(=O)C(C#N)=Cc1ccc(C(F)(F)F)cc1Br |
| HS Code | 2926909090 |
|---|
|
~82%
ethyl 3-[2-brom... CAS#:85118-34-9 |
| Literature: Bogeso Journal of Medicinal Chemistry, 1983 , vol. 26, # 7 p. 935 - 947 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Propenoic acid,3-[2-bromo-4-(trifluoromethyl)phenyl]-2-cyano-,ethyl ester |
| ethyl 3-<2-bromo-4-(trifluoromethyl)phenyl>-2-cyano-2-propenoate |
| ETHYL 3-[2-BROMO-4-(TRIFLUOROMETHYL)PHENYL]-2-CYANOACRYLATE |