methyl 2-[(2-hydroxyphenyl)methyl-[2-[(2-hydroxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate structure
|
Common Name | methyl 2-[(2-hydroxyphenyl)methyl-[2-[(2-hydroxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate | ||
|---|---|---|---|---|
| CAS Number | 85120-52-1 | Molecular Weight | 416.46800 | |
| Density | 1.249g/cm3 | Boiling Point | 541.9ºC at 760 mmHg | |
| Molecular Formula | C22H28N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.6ºC | |
| Name | methyl 2-[(2-hydroxyphenyl)methyl-[2-[(2-hydroxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 541.9ºC at 760 mmHg |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.46800 |
| Flash Point | 281.6ºC |
| Exact Mass | 416.19500 |
| PSA | 99.54000 |
| LogP | 1.74800 |
| Index of Refraction | 1.587 |
| InChIKey | ACHBABDQYBLQLC-UHFFFAOYSA-N |
| SMILES | COC(=O)CN(CCN(CC(=O)OC)Cc1ccccc1O)Cc1ccccc1O |
|
~94%
methyl 2-[(2-hy... CAS#:85120-52-1 |
| Literature: Faller, Bernard; Spanka, Carsten; Sergejew, Thomas; Tschinke, Vincenzo Journal of Medicinal Chemistry, 2000 , vol. 43, # 8 p. 1467 - 1475 |
|
~62%
methyl 2-[(2-hy... CAS#:85120-52-1 |
| Literature: Pitt, C. G.; Bao, Y.; Thompson, J.; Wani, M. C.; Rosenkrantz, H.; Metterville, J. Journal of Medicinal Chemistry, 1986 , vol. 29, # 7 p. 1231 - 1237 |
| GLYCINE,N,N'-1,2-ETHANEDIYLBIS(N-((2-HYDROXYPHENYL)METHYL)-,DIMETHYL ESTER |
| N,N'-1,2-Ethanediylbis(N-((2-hydroxyphenyl)methyl)glycine) dimethyl ester |
| N,N'-bis(2-hydroxybenzyl)ethylenediamine-N,N'-diacetic acid dimethyl ester |
| METHYL 2-[(2-HYDROXYPHENYL)METHYL-[2-[(2-HYDROXYPHENYL)METHYL-(METHOXYCARBONYLMETHYL)AMINO]ETHYL]AMINO]ACETATE |