ethyl 3-(benzyl(3-ethoxy-3-oxopropyl)amino)-2,2-difluoropropanoate structure
|
Common Name | ethyl 3-(benzyl(3-ethoxy-3-oxopropyl)amino)-2,2-difluoropropanoate | ||
|---|---|---|---|---|
| CAS Number | 851314-55-1 | Molecular Weight | 343.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23F2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-[benzyl-(3-ethoxy-3-oxopropyl)amino]-2,2-difluoropropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H23F2NO4 |
|---|---|
| Molecular Weight | 343.36600 |
| Exact Mass | 343.16000 |
| PSA | 55.84000 |
| LogP | 2.64020 |
| InChIKey | QMSSIOMZIPGJDB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCN(Cc1ccccc1)CC(F)(F)C(=O)OCC |
| HS Code | 2922509090 |
|---|
|
~%
ethyl 3-(benzyl... CAS#:851314-55-1 |
| Literature: Fujimoto, Tatsuhiko; Tomata, Yoshihide; Kunitomo, Jun; Hirozane, Mariko; Marui, Shogo Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 21 p. 6409 - 6413 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-[benzyl-(2-ethoxycarbonylethyl)amino]-2,2-difluoropropionic acid ethyl ester |
| Ethyl 3-(benzyl(3-ethoxy-3-oxopropyl)amino)-2,2-difluoropropanoate |