4-(5-Cyanopyridin-2-yl)benzaldehyde structure
|
Common Name | 4-(5-Cyanopyridin-2-yl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 851340-81-3 | Molecular Weight | 208.21500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8N2O | Melting Point | 200-202ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-formylphenyl)pyridine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 200-202ºC |
|---|---|
| Molecular Formula | C13H8N2O |
| Molecular Weight | 208.21500 |
| Exact Mass | 208.06400 |
| PSA | 53.75000 |
| LogP | 2.43278 |
| InChIKey | QHBXHUMKKRNYKM-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(-c2ccc(C=O)cc2)nc1 |
| HS Code | 2933399090 |
|---|
|
~79%
4-(5-Cyanopyrid... CAS#:851340-81-3 |
| Literature: Ismail, Mohamed A.; Batista-Parra, Adalgisa; Miao, Yi; Wilson, W. David; Wenzler, Tanja; Brun, Reto; Boykin, David W. Bioorganic and Medicinal Chemistry, 2005 , vol. 13, # 24 p. 6718 - 6726 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(5-Cyanopyridin-2-yl)benzaldehyde |
| 6-(4-formylphenyl)-nicotinonitrile |
| formylphenylnicotinonitrile |