4-(tert-butyl)cyclohexyl 3,3-dimethylbutyrate
4-(tert-butyl)cyclohexyl 3,3-dimethylbutyrate structure
|
Common Name | 4-(tert-butyl)cyclohexyl 3,3-dimethylbutyrate | ||
|---|---|---|---|---|
| CAS Number | 85136-35-2 | Molecular Weight | 254.40800 | |
| Density | 0.91g/cm3 | Boiling Point | 270.2ºC at 760 mmHg | |
| Molecular Formula | C16H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.91g/cm3 |
|---|---|
| Boiling Point | 270.2ºC at 760 mmHg |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.40800 |
| Flash Point | 127.3ºC |
| Exact Mass | 254.22500 |
| PSA | 26.30000 |
| LogP | 4.57070 |
| Index of Refraction | 1.456 |
| InChIKey | LPQUATADXCTKFO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)OC1CCC(C(C)(C)C)CC1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-(tert-Butyl)cyclohexyl 3,3-dimethylbutyrate |
| EINECS 285-759-8 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate have? |
| A: English synonyms of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate: 4-(tert-Butyl)cyclohexyl 3,3-dimethylbutyrate, EINECS 285-759-8. |
| Q: What is the SMILES notation of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate? |
| A: SMILES notation of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate is CC(C)(C)CC(=O)OC1CCC(C(C)(C)C)CC1. |
| Q: What is the molecular weight of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate? |
| A: Molecular weight of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate is 254.40800. |
| Q: What is the CAS number of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate? |
| A: CAS number of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate is 85136-35-2. |
| Q: What is the Chinese name of 85136-35-2? |
| A: Chinese name of 85136-35-2 is 85136-35-2. |
| Q: What is the molecular formula of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate? |
| A: Molecular formula of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate is C16H30O2. |
| Q: What is the English name of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate? |
| A: The English name of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate is (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate. |
| Q: What is the LogP of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate? |
| A: LogP of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate is 4.57070. |
| Q: What is the boiling point of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate? |
| A: Boiling point of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate is 270.2ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate? |
| A: Polar surface area (PSA) of (4-tert-butylcyclohexyl) 3,3-dimethylbutanoate is 26.30000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |