Benzyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate structure
|
Common Name | Benzyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 85151-16-2 | Molecular Weight | 264.32000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20N2O3 |
|---|---|
| Molecular Weight | 264.32000 |
| Exact Mass | 264.14700 |
| PSA | 75.79000 |
| LogP | 1.74700 |
| InChIKey | LWIUVSBTWBNGLT-UHFFFAOYSA-N |
| SMILES | NCC1(O)CCN(C(=O)OCc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~%
Benzyl 4-(amino... CAS#:85151-16-2 |
| Literature: Claiborne, Christopher F.; Butcher, John W.; Claremon, David A.; Libby, Brian E.; Liverton, Nigel J.; Munson, Peter M.; Nguyen, Kevin T.; Phillips, Brian; Thompson, Wayne; McCauley, John A. Patent: US2002/165241 A1, 2002 ; |
|
~99%
Benzyl 4-(amino... CAS#:85151-16-2 |
| Literature: Clark; Caroon; Repke; Strosberg; Bitter; Okada; Michel; Whiting Journal of Medicinal Chemistry, 1983 , vol. 26, # 6 p. 855 - 861 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-[1-(4-fluorobenzyl)piperidin-4-yl]methanamine |
| {1-[(4-fluorophenyl)methyl]-4-piperidyl}methylamine |
| 4-aminomethyl-1-(p-fluorobenzyl)piperidine |
| [1-(4-fluorobenzyl)piperidin-4-yl]methylamine |
| {1-[(4-fluorophenyl)methyl]piperidin-4-yl}methanamine |
| 4-aminomethyl-1-CBZ-piperidin-4-ol |