(1-(4-chlorobenzyl)-2-oxohydrazino)(phenyl)acetic acid structure
|
Common Name | (1-(4-chlorobenzyl)-2-oxohydrazino)(phenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 85152-74-5 | Molecular Weight | 304.72800 | |
| Density | 1.3g/cm3 | Boiling Point | 532ºC at 760 mmHg | |
| Molecular Formula | C15H13ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.6ºC | |
| Name | 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 532ºC at 760 mmHg |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.72800 |
| Flash Point | 275.6ºC |
| Exact Mass | 304.06100 |
| PSA | 69.97000 |
| LogP | 3.64930 |
| Index of Refraction | 1.607 |
| InChIKey | WBRGEXSDDDAVMU-UHFFFAOYSA-N |
| SMILES | O=NN(Cc1ccc(Cl)cc1)C(C(=O)O)c1ccccc1 |
|
~53%
(1-(4-chloroben... CAS#:85152-74-5 |
| Literature: Nakajima, Masayuki; Anselme, Jean-Pierre Journal of Organic Chemistry, 1983 , vol. 48, # 9 p. 1444 - 1448 |
|
~%
(1-(4-chloroben... CAS#:85152-74-5 |
| Literature: Nakajima, Masayuki; Anselme, Jean-Pierre Journal of Organic Chemistry, 1983 , vol. 48, # 9 p. 1444 - 1448 |
|
~%
(1-(4-chloroben... CAS#:85152-74-5 |
| Literature: Nakajima, Masayuki; Anselme, Jean-Pierre Journal of Organic Chemistry, 1983 , vol. 48, # 9 p. 1444 - 1448 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|