(1-(4-chlorobenzyl)-2-oxohydrazino)(phenyl)acetic acid
(1-(4-chlorobenzyl)-2-oxohydrazino)(phenyl)acetic acid structure
|
Common Name | (1-(4-chlorobenzyl)-2-oxohydrazino)(phenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 85152-74-5 | Molecular Weight | 304.72800 | |
| Density | 1.3g/cm3 | Boiling Point | 532ºC at 760 mmHg | |
| Molecular Formula | C15H13ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.6ºC | |
Summary: 2-[(4-Chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid (also known as (1-(4-chlorobenzyl)-2-oxohydrazino)(phenyl)acetic acid) is a chemical compound with CAS number 85152-74-5, molecular formula C15H13ClN2O3, and molecular weight 304.72800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 532ºC at 760 mmHg |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.72800 |
| Flash Point | 275.6ºC |
| Exact Mass | 304.06100 |
| PSA | 69.97000 |
| LogP | 3.64930 |
| Index of Refraction | 1.607 |
| InChIKey | WBRGEXSDDDAVMU-UHFFFAOYSA-N |
| SMILES | O=NN(Cc1ccc(Cl)cc1)C(C(=O)O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~53%
(1-(4-chloroben... CAS#:85152-74-5 |
| Literature: Nakajima, Masayuki; Anselme, Jean-Pierre Journal of Organic Chemistry, 1983 , vol. 48, # 9 p. 1444 - 1448 |
|
~%
(1-(4-chloroben... CAS#:85152-74-5 |
| Literature: Nakajima, Masayuki; Anselme, Jean-Pierre Journal of Organic Chemistry, 1983 , vol. 48, # 9 p. 1444 - 1448 |
|
~%
(1-(4-chloroben... CAS#:85152-74-5 |
| Literature: Nakajima, Masayuki; Anselme, Jean-Pierre Journal of Organic Chemistry, 1983 , vol. 48, # 9 p. 1444 - 1448 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid? |
| A: LogP of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid is 3.64930. |
| Q: What is the boiling point of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid? |
| A: Boiling point of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid is 532ºC at 760 mmHg. |
| Q: What are the upstream materials of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid? |
| A: Related upstream materials(CAS) of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid: 85152-73-4;4870-65-9;104-86-9. |
| Q: What is the English name of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid? |
| A: The English name of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid is 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid. |
| Q: What is the molecular formula of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid? |
| A: Molecular formula of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid is C15H13ClN2O3. |
| Q: What is the Chinese name of 85152-74-5? |
| A: Chinese name of 85152-74-5 is 85152-74-5. |
| Q: What is the CAS number of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid? |
| A: CAS number of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid is 85152-74-5. |
| Q: What is the InChIKey of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid? |
| A: InChIKey of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid is WBRGEXSDDDAVMU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid? |
| A: SMILES notation of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid is O=NN(Cc1ccc(Cl)cc1)C(C(=O)O)c1ccccc1. |
| Q: What is the molecular weight of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid? |
| A: Molecular weight of 2-[(4-chlorophenyl)methyl-nitrosoamino]-2-phenylacetic acid is 304.72800. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |