methyl dihydrogen phosphate, compound with guanidine (1:2) structure
|
Common Name | methyl dihydrogen phosphate, compound with guanidine (1:2) | ||
|---|---|---|---|---|
| CAS Number | 85153-70-4 | Molecular Weight | 230.16300 | |
| Density | N/A | Boiling Point | 513.2ºC at 760 mmHg | |
| Molecular Formula | C3H15N6O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.2ºC | |
| Name | guanidine,methyl dihydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 513.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C3H15N6O4P |
| Molecular Weight | 230.16300 |
| Flash Point | 264.2ºC |
| Exact Mass | 230.08900 |
| PSA | 228.35000 |
| LogP | 0.40330 |
| InChIKey | XSMZYGOJSXGNLE-UHFFFAOYSA-N |
| SMILES | COP(=O)(O)O.N=C(N)N.N=C(N)N |
| Methyl dihydrogen phosphate,compound with guanidine (1:2) |
| EINECS 285-853-9 |