5-oxo-L-proline, compound with pyridine-3-carboxamide (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with pyridine-3-carboxamide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 85153-85-1 | Molecular Weight | 251.23900 | |
| Density | N/A | Boiling Point | 666.9ºC at 760 mmHg | |
| Molecular Formula | C11H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 357.1ºC | |
| Name | (2S)-5-oxopyrrolidine-2-carboxylic acid,pyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 666.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.23900 |
| Flash Point | 357.1ºC |
| Exact Mass | 251.09100 |
| PSA | 126.86000 |
| LogP | 0.69020 |
| InChIKey | TVFPTMXWRJNBSZ-HVDRVSQOSA-N |
| SMILES | NC(=O)c1cccnc1.O=C1CCC(C(=O)O)N1 |
| einecs 285-870-1 |