lactic acid, compound with 2-[[4-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]phenyl]sulphonyl]-1,N,N-trimethylethylamine (1:1) structure
|
Common Name | lactic acid, compound with 2-[[4-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]phenyl]sulphonyl]-1,N,N-trimethylethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 85154-08-1 | Molecular Weight | 496.01900 | |
| Density | N/A | Boiling Point | 563.6ºC at 760 mmHg | |
| Molecular Formula | C23H30ClN3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.6ºC | |
| Name | 1-[4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonyl-N,N-dimethylpropan-2-amine,2-hydroxypropanoic acid |
|---|
| Boiling Point | 563.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H30ClN3O5S |
| Molecular Weight | 496.01900 |
| Flash Point | 294.6ºC |
| Exact Mass | 495.15900 |
| PSA | 118.89000 |
| LogP | 3.71140 |
| InChIKey | TVBOOZZXKDXSHZ-UHFFFAOYSA-N |
| SMILES | CC(CS(=O)(=O)c1ccc(N2CCC(c3ccc(Cl)cc3)=N2)cc1)N(C)C.CC(O)C(=O)O |