(R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate
Modify Date: 2025-11-05 22:13:50
(R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate structure
|
Common Name | (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate | ||
|---|---|---|---|---|
| CAS Number | 851669-35-7 | Molecular Weight | 295.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21NO3S |
|---|---|
| Molecular Weight | 295.4 |
| InChIKey | WKGCHZYRZDNRRB-CYBMUJFWSA-N |
| SMILES | COC(=O)C(CC(C)C)NC(=O)c1ccc(SC)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate? |
| A: The English name of (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate is (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate. |
| Q: What is the SMILES notation of (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate? |
| A: SMILES notation of (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate is COC(=O)C(CC(C)C)NC(=O)c1ccc(SC)cc1. |
| Q: What is the molecular weight of (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate? |
| A: Molecular weight of (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate is 295.4. |
| Q: What is the molecular formula of (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate? |
| A: Molecular formula of (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate is C15H21NO3S. |
| Q: What is the InChIKey of (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate? |
| A: InChIKey of (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate is WKGCHZYRZDNRRB-CYBMUJFWSA-N. |
| Q: What is the Chinese name of 851669-35-7? |
| A: Chinese name of 851669-35-7 is COC(=O)C(CC(C)C)NC(=O)c1ccc(SC)cc1. |
| Q: What is the CAS number of (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate? |
| A: CAS number of (R)-methyl 4-methyl-2-(4-(methylthio)benzamido)pentanoate is 851669-35-7. |