2,2',2'',2'''-(1,2-PHENYLENEBIS((1S,3S)& structure
|
Common Name | 2,2',2'',2'''-(1,2-PHENYLENEBIS((1S,3S)& | ||
|---|---|---|---|---|
| CAS Number | 851770-14-4 | Molecular Weight | 1311.40000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C78H72N8O8P2 | Melting Point | 289-299ºC | |
| MSDS | USA | Flash Point | N/A | |
| Name | Bis[(S,S,S)-DiazaPhos-SPE] |
|---|
| Melting Point | 289-299ºC |
|---|---|
| Molecular Formula | C78H72N8O8P2 |
| Molecular Weight | 1311.40000 |
| Exact Mass | 1310.49000 |
| PSA | 224.82000 |
| LogP | 14.73460 |
| InChIKey | NTWCWWNZWYJTEP-HMVZQFFBSA-N |
| SMILES | CC(NC(=O)c1ccccc1C1N2C(=O)CCC(=O)N2C(c2ccccc2C(=O)NC(C)c2ccccc2)P1c1ccccc1P1C(c2ccccc2C(=O)NC(C)c2ccccc2)N2C(=O)CCC(=O)N2C1c1ccccc1C(=O)NC(C)c1ccccc1)c1ccccc1 |
| RIDADR | NONH for all modes of transport |
|---|
|
Highly active, regioselective, and enantioselective hydroformylation with Rh catalysts ligated by Bis-3,4-diazaphospholanes.
J. Am. Chem. Soc. 127 , 5040, (2005) Azines made by the reaction of hydrazine with ortho-formylbenzoic acid react with 1,2-diphosphinobenzene and either succinyl chloride or phthaloyl chloride in ca. 30% yield to give rac-bis-3,4-diazaph... |
|
|
Highly regio- and enantioselective asymmetric hydroformylation of olefins mediated by 2,5-disubstituted phospholane ligands.
Angew. Chem. Int. Ed. Engl. 44 , 5834, (2005)
|