(2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester
(2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester structure
|
Common Name | (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 85196-28-7 | Molecular Weight | 286.26100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10N2O6S |
|---|---|
| Molecular Weight | 286.26100 |
| Exact Mass | 286.02600 |
| PSA | 143.24000 |
| LogP | 3.20460 |
| InChIKey | BJDFTBHUSCRIHE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:21762-78-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2,4-dinitrophenyl)thioacetic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester have? |
| A: English synonyms of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester: (2,4-dinitrophenyl)thioacetic acid ethyl ester. |
| Q: What are the downstream products of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester? |
| A: Related downstream products(CAS) of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester: 21762-78-7. |
| Q: What is the LogP of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester? |
| A: LogP of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester is 3.20460. |
| Q: What is the molecular formula of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester? |
| A: Molecular formula of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester is C10H10N2O6S. |
| Q: What is the molecular weight of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester? |
| A: Molecular weight of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester is 286.26100. |
| Q: What is the Chinese name of 85196-28-7? |
| A: Chinese name of 85196-28-7 is 85196-28-7. |
| Q: What is the InChIKey of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester? |
| A: InChIKey of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester is BJDFTBHUSCRIHE-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester? |
| A: Polar surface area (PSA) of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester is 143.24000. |
| Q: What is the SMILES notation of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester? |
| A: SMILES notation of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester is CCOC(=O)CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]. |
| Q: What is the CAS number of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester? |
| A: CAS number of (2,4-dinitro-phenylsulfanyl)-acetic acid ethyl ester is 85196-28-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |