Methyl 4-(2-(5,7-dimethylbenzo[d]thiazol-2-yl)hydrazinecarbonyl)benzoate
Modify Date: 2026-04-13 11:04:06
![Methyl 4-(2-(5,7-dimethylbenzo[d]thiazol-2-yl)hydrazinecarbonyl)benzoate Structure](https://www.chemsrc.com/extcaspic/326/851987-59-2.png)
Methyl 4-(2-(5,7-dimethylbenzo[d]thiazol-2-yl)hydrazinecarbonyl)benzoate structure
|
Common Name | Methyl 4-(2-(5,7-dimethylbenzo[d]thiazol-2-yl)hydrazinecarbonyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 851987-59-2 | Molecular Weight | 355.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 4-(2-(5,7-dimethylbenzo[d]thiazol-2-yl)hydrazinecarbonyl)benzoate |
|---|
| Molecular Formula | C18H17N3O3S |
|---|---|
| Molecular Weight | 355.4 |
| InChIKey | PKOYMYGOQIKNMM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)N=C(S2)NNC(=O)C3=CC=C(C=C3)C(=O)OC)C |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1