isocyanato-dimethyl-[tris(trimethylsilyl)methyl]silane structure
|
Common Name | isocyanato-dimethyl-[tris(trimethylsilyl)methyl]silane | ||
|---|---|---|---|---|
| CAS Number | 85199-81-1 | Molecular Weight | 331.74900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H33NOSi4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | isocyanato-dimethyl-[tris(trimethylsilyl)methyl]silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H33NOSi4 |
|---|---|
| Molecular Weight | 331.74900 |
| Exact Mass | 331.16400 |
| PSA | 29.43000 |
| LogP | 4.89990 |
| InChIKey | UVSFDVUWVDCIFJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)N=C=O |
|
~%
isocyanato-dime... CAS#:85199-81-1 |
| Literature: Koehler, Helmut; Menzel, Rainer; Koehler, Michael; Jaeger, Lothar Zeitschrift fuer Chemie (Stuttgart, Germany), 1987 , vol. 27, # 8 p. 294 |
|
~%
isocyanato-dime... CAS#:85199-81-1 |
| Literature: Eaborn, Colin; Lickiss, Paul D.; Marquina-Chidsey, Germania; Thorli, Esther Y. Journal of the Chemical Society, Chemical Communications, 1982 , # 22 p. 1326 |
| [Tris(trimethylsilyl)methyl](dimethyl)silyl Isocyanate |
| Silane,[(isocyanatodimethylsilyl)methylidyne]tris[trimethyl |