4-(3,4-dicyanophenoxy)benzoic acid structure
|
Common Name | 4-(3,4-dicyanophenoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 85218-66-2 | Molecular Weight | 264.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3,4-dicyanophenoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H8N2O3 |
|---|---|
| Molecular Weight | 264.23600 |
| Exact Mass | 264.05300 |
| PSA | 94.11000 |
| LogP | 2.92046 |
| InChIKey | WBLCQMXLGKWTAV-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(Oc2ccc(C(=O)O)cc2)cc1C#N |
|
~95%
4-(3,4-dicyanop... CAS#:85218-66-2 |
| Literature: Kliesh, Holger; Weitemeyer, Andrea; Mueller, Silke; Woehrle, Dieter Liebigs Annalen, 1995 , # 7 p. 1269 - 1274 |
|
~%
4-(3,4-dicyanop... CAS#:85218-66-2 |
| Literature: Yan, Wang; Zhou, Yuqing; Wang, Xinping; Chen, Wenqi; Xi, Shiquan Journal of the Chemical Society, Chemical Communications, 1992 , # 12 p. 873 - 875 |
| 4-(4-carboxyphenoxy)phthalodinitrile |
| Benzoic acid,4-(3,4-dicyanophenoxy) |
| 4-(4-carboxy-phenoxy) phthalonitrile |
| 4-(4-carboxyphenyloxy)-phthalonitrile |
| 4-(3,4-dicyano-phenoxy)-benzoic acid |
| 4-(p-carboxyphenyloxy)phthalonitrile |