3'-azido-2',3'-dideoxy-5-iodouridine
Modify Date: 2025-10-26 07:35:23
3'-azido-2',3'-dideoxy-5-iodouridine structure
|
Common Name | 3'-azido-2',3'-dideoxy-5-iodouridine | ||
|---|---|---|---|---|
| CAS Number | 85236-92-6 | Molecular Weight | 379.11100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10IN5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H10IN5O4 |
|---|---|
| Molecular Weight | 379.11100 |
| Exact Mass | 378.97800 |
| PSA | 134.33000 |
| InChIKey | RKFULXUNGOGTPS-RRKCRQDMSA-N |
| SMILES | [N-]=[N+]=NC1CC(n2cc(I)c(=O)[nH]c2=O)OC1CO |
|
Name: In vitro inhibitory activity against Moloney murine leukemia virus (M-MULV) replicati...
Source: ChEMBL
Target: Moloney murine leukemia virus
External Id: CHEMBL736577
|
|
Name: Concentration of compound required to inhibit 50% of viral replication of human immun...
Source: ChEMBL
Target: CCRF-CEM
External Id: CHEMBL654553
|
|
Name: Concentration of compound required to inhibit 50% of host cell replication of human i...
Source: ChEMBL
Target: CCRF-CEM
External Id: CHEMBL654554
|
|
Name: Ratio of TICD50 to that of IC50 of human immunodeficiency virus (HIV-1)
Source: ChEMBL
Target: N/A
External Id: CHEMBL846730
|
|
Name: Ratio of TICD50 to that of IC50 of Rauscher-Murine leukemia virus (R-MuLv)
Source: ChEMBL
Target: N/A
External Id: CHEMBL846729
|
Total 7, Current Page 1 of 1
1
| Azidurd |
| 3'-Azido-2',3'-dideoxy-5-iodouridine |
| Uridine,3'-azido-2',3'-dideoxy-5-iodo |
| 5-I-AZU |
| AZddIU |
| 3'-N3-5-I-ddU |