2,6-Di-tert-butylpiperidine
2,6-Di-tert-butylpiperidine structure
|
Common Name | 2,6-Di-tert-butylpiperidine | ||
|---|---|---|---|---|
| CAS Number | 85237-75-8 | Molecular Weight | 197.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H27N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-Di-tert-butylpiperidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H27N |
|---|---|
| Molecular Weight | 197.36000 |
| Exact Mass | 197.21400 |
| PSA | 12.03000 |
| LogP | 3.91810 |
| InChIKey | ZOYHTWUFFGGARK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCCC(C(C)(C)C)N1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933399090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:585-48-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2,6-Di-tert-butylpiperidine? |
| A: LogP of 2,6-Di-tert-butylpiperidine is 3.91810. |
| Q: What is the SMILES notation of 2,6-Di-tert-butylpiperidine? |
| A: SMILES notation of 2,6-Di-tert-butylpiperidine is CC(C)(C)C1CCCC(C(C)(C)C)N1. |
| Q: What is the Chinese name of 85237-75-8? |
| A: Chinese name of 85237-75-8 is 85237-75-8. |
| Q: What is the polar surface area (PSA) of 2,6-Di-tert-butylpiperidine? |
| A: Polar surface area (PSA) of 2,6-Di-tert-butylpiperidine is 12.03000. |
| Q: What is the English name of 2,6-Di-tert-butylpiperidine? |
| A: The English name of 2,6-Di-tert-butylpiperidine is 2,6-Di-tert-butylpiperidine. |
| Q: What is the molecular weight of 2,6-Di-tert-butylpiperidine? |
| A: Molecular weight of 2,6-Di-tert-butylpiperidine is 197.36000. |
| Q: What is the CAS number of 2,6-Di-tert-butylpiperidine? |
| A: CAS number of 2,6-Di-tert-butylpiperidine is 85237-75-8. |
| Q: What is the molecular formula of 2,6-Di-tert-butylpiperidine? |
| A: Molecular formula of 2,6-Di-tert-butylpiperidine is C13H27N. |
| Q: What is the InChIKey of 2,6-Di-tert-butylpiperidine? |
| A: InChIKey of 2,6-Di-tert-butylpiperidine is ZOYHTWUFFGGARK-UHFFFAOYSA-N. |
| Q: What are the downstream products of 2,6-Di-tert-butylpiperidine? |
| A: Related downstream products(CAS) of 2,6-Di-tert-butylpiperidine: 585-48-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |