1,4-Ethanonaphthalen-9-one,decahydro-1,2,7-trihydroxy-10-(hydroxymethylene)-2,4,5,7-tetramethyl-3-[(1R)-1-methylpropyl]-,(1S,2S,3R,4R,4aS,5R,7R,8aS,10Z)- structure
|
Common Name | 1,4-Ethanonaphthalen-9-one,decahydro-1,2,7-trihydroxy-10-(hydroxymethylene)-2,4,5,7-tetramethyl-3-[(1R)-1-methylpropyl]-,(1S,2S,3R,4R,4aS,5R,7R,8aS,10Z)- | ||
|---|---|---|---|---|
| CAS Number | 85269-22-3 | Molecular Weight | 366.49200 | |
| Density | 1.24g/cm3 | Boiling Point | 499ºC at 760mmHg | |
| Molecular Formula | C21H34O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.7ºC | |
| Name | (10Z)-12-butan-2-yl-5,8,11-trihydroxy-10-(hydroxymethylidene)-1,3,5,11-tetramethyl-2,3,4,6,7,12-hexahydrotricyclo[6.2.2.02,7]dodeca-3,9-dien-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 499ºC at 760mmHg |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.49200 |
| Flash Point | 269.7ºC |
| Exact Mass | 366.24100 |
| PSA | 97.99000 |
| LogP | 2.58860 |
| Index of Refraction | 1.599 |
| InChIKey | FHJXKTOXQHRDTL-PSWVRJCXSA-N |
| SMILES | CCC(C)C1C2(C)C(=O)C(=CO)C(O)(C3CC(C)(O)CC(C)C32)C1(C)O |
|
~%
1,4-Ethanonapht... CAS#:85269-22-3 |
| Literature: Ichihara,A.; Oikawa,H.; Hayashi,K. Journal of the American Chemical Society, 1983 , vol. 105, p. 2907 |
|
~%
1,4-Ethanonapht... CAS#:85269-22-3 |
| Literature: Ichihara,A.; Oikawa,H.; Hayashi,K. Journal of the American Chemical Society, 1983 , vol. 105, p. 2907 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| betaenone a |