17-Phenyl-18,19,20-trinor-prostaglandin D2 structure
|
Common Name | 17-Phenyl-18,19,20-trinor-prostaglandin D2 | ||
|---|---|---|---|---|
| CAS Number | 85280-91-7 | Molecular Weight | 386.481 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 615.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.1±28.0 °C | |
Use of 17-Phenyl-18,19,20-trinor-prostaglandin D217-phenyl trinor Prostaglandin D2 (17-phenyl trinor PGD2) is a novel, chemically stable analog of PGD2 wherein the lower side chain is modified by the addition of a phenyl group at C-17 in place of the last 3 ω-chain carbon atoms. |
| Name | 17-phenyl-18,19,20-trinor-PGD2 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 615.6±55.0 °C at 760 mmHg |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.481 |
| Flash Point | 340.1±28.0 °C |
| Exact Mass | 386.209320 |
| PSA | 94.83000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | OAQGPAZDRCBBLD-YTCWWFNZSA-N |
| SMILES | O=C(O)CCCC=CCC1C(O)CC(=O)C1C=CC(O)CCc1ccccc1 |
| (5Z)-7-{(1R,2R,5S)-5-Hydroxy-2-[(1E,3S)-3-hydroxy-5-phenyl-1-penten-1-yl]-3-oxocyclopentyl}-5-heptenoic acid |
| (Z)-7-[(1R,2R,5S)-5-Hydroxy-2-((E)-(S)-3-hydroxy-5-phenyl-pent-1-enyl)-3-oxo-cyclopentyl]-hept-5-enoic acid |
| (5Z,13E)-(8R,9S,12R,15S)-9,15-dihydroxy-11-oxo-17-phenyl-18,19,20-trinor-prostadienoic acid |
| 5-Heptenoic acid, 7-[(1R,2R,5S)-5-hydroxy-2-[(1E,3S)-3-hydroxy-5-phenyl-1-penten-1-yl]-3-oxocyclopentyl]-, (5Z)- |
| 17-phenyl trinor PGD2 |
| 17-Phenyl-18,19,20-trinor-prostaglandin D2 |