9-(4-chlorophenyl)-3,5-dimethoxy-2,4,8,9-tetrazabicyclo[4.3.0]nona-2,4,7,10-tetraene structure
|
Common Name | 9-(4-chlorophenyl)-3,5-dimethoxy-2,4,8,9-tetrazabicyclo[4.3.0]nona-2,4,7,10-tetraene | ||
|---|---|---|---|---|
| CAS Number | 85293-23-8 | Molecular Weight | 290.70500 | |
| Density | 1.44g/cm3 | Boiling Point | 403.1ºC at 760 mmHg | |
| Molecular Formula | C13H11ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.6ºC | |
| Name | 1-(4-chlorophenyl)-4,6-dimethoxypyrazolo[3,4-d]pyrimidine |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 403.1ºC at 760 mmHg |
| Molecular Formula | C13H11ClN4O2 |
| Molecular Weight | 290.70500 |
| Flash Point | 197.6ºC |
| Exact Mass | 290.05700 |
| PSA | 62.06000 |
| LogP | 2.48610 |
| Index of Refraction | 1.664 |
| InChIKey | NKBKLVJYZODBCQ-UHFFFAOYSA-N |
| SMILES | COc1nc(OC)c2cnn(-c3ccc(Cl)cc3)c2n1 |
|
~66%
9-(4-chlorophen... CAS#:85293-23-8 |
| Literature: Senga; Robins Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 6 p. 1565 - 1567 |
|
~%
9-(4-chlorophen... CAS#:85293-23-8 |
| Literature: Senga; Robins Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 6 p. 1565 - 1567 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |