Cyclopentanone,2-cyclopentylidene-, 2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | Cyclopentanone,2-cyclopentylidene-, 2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 853-96-3 | Molecular Weight | 330.33900 | |
| Density | 1.46g/cm3 | Boiling Point | 493.2ºC at 760 mmHg | |
| Molecular Formula | C16H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.1ºC | |
| Name | N-[(2-cyclopentylidenecyclopentylidene)amino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 493.2ºC at 760 mmHg |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.33900 |
| Flash Point | 252.1ºC |
| Exact Mass | 330.13300 |
| PSA | 116.03000 |
| LogP | 5.44480 |
| Index of Refraction | 1.691 |
| InChIKey | YGWRVUUUCUHZGP-SAPNQHFASA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=C2CCCC2=C2CCCC2)c([N+](=O)[O-])c1 |
|
~%
Cyclopentanone,... CAS#:853-96-3 |
| Literature: Marvel; Brooks Journal of the American Chemical Society, 1941 , vol. 63, p. 2853 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Oxy-dicyclopentyl |
| 2-Cylopentyl-cyclopentanol-(1) |
| Bicyclopentyliden-2-on-(2,4-dinitro-phenylhydrazon) |
| (1,1'-Bicyclopentyl)-2-ol |
| bicyclopentyliden-2-one-(2,4-dinitro-phenylhydrazone) |
| 2-<Cyclopentyliden>-cyclopentanon-<2,4-dinitro-phenylhydrazon> |
| 1-Cyclopentyl-cyclopentanol-(2) |
| 2-Cyclopentylcyclopentanol |
| 2-Hydroxy-1-cyclopentyl-cyclopentan |
| [Bicyclopentyl]-2-ol |
| Cyclopentyliden-cyclopentanon-(2,4-dinitro-phenylhydrazon) |