N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide
Modify Date: 2026-07-16 18:59:25
![N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide Structure](https://www.chemsrc.com/extcaspic/106/853333-26-3.png)
N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide structure
|
Common Name | N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide | ||
|---|---|---|---|---|
| CAS Number | 853333-26-3 | Molecular Weight | 377.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H15F4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H15F4NO2 |
|---|---|
| Molecular Weight | 377.3 |
| InChIKey | LBYVJUPAAJLOAI-UHFFFAOYSA-N |
| SMILES | O=C(CCc1ccc(-c2ccccc2C(F)(F)F)o1)Nc1ccc(F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide? |
| A: SMILES notation of N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide is O=C(CCc1ccc(-c2ccccc2C(F)(F)F)o1)Nc1ccc(F)cc1. |
| Q: What is the Chinese name of 853333-26-3? |
| A: Chinese name of 853333-26-3 is 853333-26-3. |
| Q: What is the molecular weight of N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide? |
| A: Molecular weight of N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide is 377.3. |
| Q: What is the English name of N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide? |
| A: The English name of N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide is N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide. |
| Q: What is the molecular formula of N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide? |
| A: Molecular formula of N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide is C20H15F4NO2. |
| Q: What is the CAS number of N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide? |
| A: CAS number of N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide is 853333-26-3. |
| Q: What is the InChIKey of N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide? |
| A: InChIKey of N-(4-fluorophenyl)-3-{5-[2-(trifluoromethyl)phenyl]-2-furyl}propanamide is LBYVJUPAAJLOAI-UHFFFAOYSA-N. |