2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide
Modify Date: 2026-08-21 19:49:32
2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide structure
|
Common Name | 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 853333-46-7 | Molecular Weight | 414.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H24BrN3O |
|---|---|
| Molecular Weight | 414.3 |
| InChIKey | GFSVHRMCHUOXHN-UHFFFAOYSA-N |
| SMILES | Br.COc1ccc(-c2cc(N3CCNCC3C)c3ccccc3n2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide? |
| A: Molecular formula of 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide is C21H24BrN3O. |
| Q: What is the SMILES notation of 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide? |
| A: SMILES notation of 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide is Br.COc1ccc(-c2cc(N3CCNCC3C)c3ccccc3n2)cc1. |
| Q: What is the molecular weight of 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide? |
| A: Molecular weight of 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide is 414.3. |
| Q: What is the English name of 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide? |
| A: The English name of 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide is 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide. |
| Q: What is the InChIKey of 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide? |
| A: InChIKey of 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide is GFSVHRMCHUOXHN-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide? |
| A: CAS number of 2-(4-Methoxyphenyl)-4-(2-methylpiperazin-1-yl)quinoline hydrobromide is 853333-46-7. |
| Q: What is the Chinese name of 853333-46-7? |
| A: Chinese name of 853333-46-7 is 853333-46-7. |