(4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole
Modify Date: 2026-08-03 12:16:02
(4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole structure
|
Common Name | (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole | ||
|---|---|---|---|---|
| CAS Number | 85355-67-5 | Molecular Weight | 363.43000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H17NO3S |
|---|---|
| Molecular Weight | 363.43000 |
| Exact Mass | 363.09300 |
| PSA | 64.11000 |
| LogP | 4.84550 |
| InChIKey | NFWNWVCHTMCZAF-UXHICEINSA-N |
| SMILES | O=S(=O)(C1=NOC(c2ccccc2)C1c1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole? |
| A: CAS number of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole is 85355-67-5. |
| Q: What is the LogP of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole? |
| A: LogP of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole is 4.84550. |
| Q: What is the molecular formula of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole? |
| A: Molecular formula of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole is C21H17NO3S. |
| Q: What is the polar surface area (PSA) of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole? |
| A: Polar surface area (PSA) of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole is 64.11000. |
| Q: What is the InChIKey of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole? |
| A: InChIKey of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole is NFWNWVCHTMCZAF-UXHICEINSA-N. |
| Q: What is the Chinese name of 85355-67-5? |
| A: Chinese name of 85355-67-5 is 85355-67-5. |
| Q: What is the English name of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole? |
| A: The English name of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole is (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole. |
| Q: What is the SMILES notation of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole? |
| A: SMILES notation of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole is O=S(=O)(C1=NOC(c2ccccc2)C1c1ccccc1)c1ccccc1. |
| Q: What is the molecular weight of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole? |
| A: Molecular weight of (4S,5S)-3-(benzenesulfonyl)-4,5-diphenyl-4,5-dihydro-1,2-oxazole is 363.43000. |