3-bromo-4-(trifluoromethoxy)benzaldehyde structure
|
Common Name | 3-bromo-4-(trifluoromethoxy)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 85366-66-1 | Molecular Weight | 269.01500 | |
| Density | 1.706g/cm3 | Boiling Point | 246.201ºC at 760 mmHg | |
| Molecular Formula | C8H4BrF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102.699ºC | |
| Name | 3-bromo-4-(trifluoromethoxy)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.706g/cm3 |
|---|---|
| Boiling Point | 246.201ºC at 760 mmHg |
| Molecular Formula | C8H4BrF3O2 |
| Molecular Weight | 269.01500 |
| Flash Point | 102.699ºC |
| Exact Mass | 267.93500 |
| PSA | 26.30000 |
| LogP | 3.16020 |
| Index of Refraction | 1.519 |
| InChIKey | OCIAOFZMQWTYNX-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(OC(F)(F)F)c(Br)c1 |
| HS Code | 2913000090 |
|---|
|
~%
3-bromo-4-(trif... CAS#:85366-66-1 |
| Literature: US2003/144329 A1, ; |
|
~%
3-bromo-4-(trif... CAS#:85366-66-1 |
| Literature: US4529557 A1, ; |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| CL8996 |
| 3-bromo-4-trifluoromethoxybenzaldehyde |