tert-Butyl 4-(5H-pyrrolo[3,2-d]pyrimidin-4-yl)piperazine-1-carboxylate structure
|
Common Name | tert-Butyl 4-(5H-pyrrolo[3,2-d]pyrimidin-4-yl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 853679-45-5 | Molecular Weight | 303.36000 | |
| Density | 1.27g/cm3 | Boiling Point | 489.484ºC at 760 mmHg | |
| Molecular Formula | C15H21N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.831ºC | |
| Name | tert-Butyl 4-(5H-pyrrolo[3,2-d]pyrimidin-4-yl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 489.484ºC at 760 mmHg |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.36000 |
| Flash Point | 249.831ºC |
| Exact Mass | 303.17000 |
| PSA | 74.35000 |
| LogP | 2.01790 |
| Index of Refraction | 1.615 |
| InChIKey | SFKDKZSJPKEFRO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncnc3cc[nH]c23)CC1 |
| HS Code | 2933990090 |
|---|
|
~53%
tert-Butyl 4-(5... CAS#:853679-45-5 |
| Literature: ARRAY BIOPHARMA INC. Patent: WO2005/51304 A2, 2005 ; Location in patent: Page/Page column 68-69 ; WO 2005/051304 A2 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(5H-pyrrolo[3,2-d]pyrimidin-4-yl)-piperazine-1-carboxylic acid tert-butyl ester |