5'-Chloro-1'-phenethylspiro[[1,3]dioxane-2,3'-indolin]-2'-one structure
|
Common Name | 5'-Chloro-1'-phenethylspiro[[1,3]dioxane-2,3'-indolin]-2'-one | ||
|---|---|---|---|---|
| CAS Number | 853751-71-0 | Molecular Weight | 343.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5'-Chloro-1'-phenethylspiro[[1,3]dioxane-2,3'-indolin]-2'-one |
|---|
| Molecular Formula | C19H18ClNO3 |
|---|---|
| Molecular Weight | 343.8 |
| InChIKey | NHIZOMANDAHMEY-UHFFFAOYSA-N |
| SMILES | C1COC2(C3=C(C=CC(=C3)Cl)N(C2=O)CCC4=CC=CC=C4)OC1 |
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|