6-[(E)-2-(4-methylphenyl)vinyl]-3-pyridin-4-yl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole structure
|
Common Name | 6-[(E)-2-(4-methylphenyl)vinyl]-3-pyridin-4-yl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole | ||
|---|---|---|---|---|
| CAS Number | 853891-81-3 | Molecular Weight | 319.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[(E)-2-(4-methylphenyl)vinyl]-3-pyridin-4-yl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|
| Molecular Formula | C17H13N5S |
|---|---|
| Molecular Weight | 319.4 |
| InChIKey | LDBTVSDTEYOFNV-VOTSOKGWSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C/C2=NN3C(=NN=C3S2)C4=CC=NC=C4 |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|