sodium (R)-3-phenyllactate
Modify Date: 2025-11-29 22:08:30
sodium (R)-3-phenyllactate structure
|
Common Name | sodium (R)-3-phenyllactate | ||
|---|---|---|---|---|
| CAS Number | 85391-15-7 | Molecular Weight | 188.15600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,(2R)-2-hydroxy-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9NaO3 |
|---|---|
| Molecular Weight | 188.15600 |
| Exact Mass | 188.04500 |
| PSA | 60.36000 |
| InChIKey | DVSAFLNBVQKEKE-DDWIOCJRSA-M |
| SMILES | O=C([O-])C(O)Cc1ccccc1.[Na+] |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| einecs 286-767-4 |