2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(dihydro-2,4-dioxo-3(2H)-furanylidene)- structure
|
Common Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(dihydro-2,4-dioxo-3(2H)-furanylidene)- | ||
|---|---|---|---|---|
| CAS Number | 85422-51-1 | Molecular Weight | 224.12700 | |
| Density | 1.811g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H4N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2,4-dioxooxolan-3-ylidene)-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.811g/cm3 |
|---|---|
| Molecular Formula | C8H4N2O6 |
| Molecular Weight | 224.12700 |
| Exact Mass | 224.00700 |
| PSA | 118.64000 |
| Index of Refraction | 1.62 |
| InChIKey | GWMKPMNCTOIDCN-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(=C2C(=O)COC2=O)C(=O)N1 |
|
~82%
2,4,6(1H,3H,5H)... CAS#:85422-51-1 |
| Literature: Grob Schmidt, Diane; Seemuth, Paul D.; Zimmer, Hans Journal of Organic Chemistry, 1983 , vol. 48, # 11 p. 1914 - 1916 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-(4,5-Dihydro-2,4-dioxo-3(2H)-furanylidene)-2,4,6-(1H,3H,5H)-pyrimidinetrione |