5-ethyl-5-phenyl-6-propan-2-yloxy-pyrimidine-2,4-dione structure
|
Common Name | 5-ethyl-5-phenyl-6-propan-2-yloxy-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 85432-39-9 | Molecular Weight | 274.31500 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-ethyl-5-phenyl-6-propan-2-yloxypyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.31500 |
| Exact Mass | 274.13200 |
| PSA | 71.25000 |
| LogP | 2.11920 |
| Index of Refraction | 1.571 |
| InChIKey | CCEXTQVHYYYTOI-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)N=C1OC(C)C |
| HS Code | 2933599090 |
|---|
|
~21%
5-ethyl-5-pheny... CAS#:85432-39-9 |
| Literature: Menez; Bourin; Colombel; et al. European Journal of Medicinal Chemistry, 1983 , vol. 18, # 6 p. 521 - 529 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl-5 phenyl-5 isopropyloxy-4 pyrimidinedione-2,6 [French] |
| 5-ethyl-5-phenyl-4-isopropyloxy-2,6-pyrimidinedione |
| 2,4(3H,5H)-Pyrimidinedione,5-ethyl-6-(1-methylethoxy)-5-phenyl |
| Uracil,5-ethyl-6-isopropoxy-5-phenyl |
| 5-Ethyl-6-isopropoxy-5-phenyluracil |
| 5-ETHYL-5-PHENYL-6-PROPAN-2-YLOXY-PYRIMIDINE-2,4-DIONE |