ethyl 6-(4-iodophenyl)-6-oxohexanoate
Modify Date: 2025-10-23 17:14:29
ethyl 6-(4-iodophenyl)-6-oxohexanoate structure
|
Common Name | ethyl 6-(4-iodophenyl)-6-oxohexanoate | ||
|---|---|---|---|---|
| CAS Number | 854658-72-3 | Molecular Weight | 360.18700 | |
| Density | 1.466g/cm3 | Boiling Point | 411.1ºC at 760 mmHg | |
| Molecular Formula | C14H17IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | ethyl 6-(4-iodophenyl)-6-oxohexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 411.1ºC at 760 mmHg |
| Molecular Formula | C14H17IO3 |
| Molecular Weight | 360.18700 |
| Flash Point | 202.4ºC |
| Exact Mass | 360.02200 |
| PSA | 43.37000 |
| LogP | 3.59740 |
| Index of Refraction | 1.554 |
| InChIKey | ZUWNSPNKRJDBTI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCC(=O)c1ccc(I)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
ethyl 6-(4-iodo... CAS#:854658-72-3 |
| Literature: Journal of the American Chemical Society, , vol. 64, p. 1436,1438 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 6-(4-iodo-phenyl)-6-oxo-hexanoic acid ethyl ester |
| 6-(4-Jod-phenyl)-6-oxo-hexansaeure-aethylester |