1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione
Modify Date: 2025-09-10 02:46:16
![1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione Structure](https://www.chemsrc.com/extcaspic/127/855401-44-4.png)
1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione structure
|
Common Name | 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 855401-44-4 | Molecular Weight | 201.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H7NO3 |
|---|---|
| Molecular Weight | 201.18 |
| InChIKey | QBBPNPLZOCHBSW-UHFFFAOYSA-N |
| SMILES | O=C1Cn2c(cc3ccccc32)C(=O)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 855401-44-4? |
| A: Chinese name of 855401-44-4 is 855401-44-4. |
| Q: What is the CAS number of 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione? |
| A: CAS number of 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione is 855401-44-4. |
| Q: What is the InChIKey of 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione? |
| A: InChIKey of 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione is QBBPNPLZOCHBSW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione? |
| A: Molecular weight of 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione is 201.18. |
| Q: What is the SMILES notation of 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione? |
| A: SMILES notation of 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione is O=C1Cn2c(cc3ccccc32)C(=O)O1. |
| Q: What is the molecular formula of 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione? |
| A: Molecular formula of 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione is C11H7NO3. |
| Q: What is the English name of 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione? |
| A: The English name of 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione is 1H,3H,4H-[1,4]oxazino[4,3-a]indole-1,3-dione. |