2-(1-chloronaphthalene-2-carbonyl)benzoic acid
2-(1-chloronaphthalene-2-carbonyl)benzoic acid structure
|
Common Name | 2-(1-chloronaphthalene-2-carbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 855471-67-9 | Molecular Weight | 310.73100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1-chloronaphthalene-2-carbonyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H11ClO3 |
|---|---|
| Molecular Weight | 310.73100 |
| Exact Mass | 310.04000 |
| PSA | 54.37000 |
| LogP | 4.42240 |
| InChIKey | KCBPUMJQOWGIER-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccc2ccccc2c1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(1-chloronaph... CAS#:855471-67-9 |
| Literature: I.G. Farbenind. Patent: DE590579 , 1932 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 20, p. 1293 Full Text Show Details Waldmann; Polak Journal fuer Praktische Chemie (Leipzig), 1938 , vol. <2> 150, p. 113,120 |
![Benzoic acid,2-[(1-hydroxy-2-naphthalenyl)carbonyl] structure](https://image.chemsrc.com/caspic/009/59198-77-5.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(1-Chlor-[2]naphthoyl)-benzoesaeure |
| Benzoic acid,2-[(1-chloro-2-naphthalenyl)carbonyl] |
| 2-(1-chloro-[2]naphthoyl)-benzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid? |
| A: CAS number of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid is 855471-67-9. |
| Q: What is the Chinese name of 855471-67-9? |
| A: Chinese name of 855471-67-9 is 855471-67-9. |
| Q: What is the molecular formula of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid? |
| A: Molecular formula of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid is C18H11ClO3. |
| Q: What is the SMILES notation of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid? |
| A: SMILES notation of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid is O=C(O)c1ccccc1C(=O)c1ccc2ccccc2c1Cl. |
| Q: What English synonyms does 2-(1-chloronaphthalene-2-carbonyl)benzoic acid have? |
| A: English synonyms of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid: 2-(1-Chlor-[2]naphthoyl)-benzoesaeure, Benzoic acid,2-[(1-chloro-2-naphthalenyl)carbonyl], 2-(1-chloro-[2]naphthoyl)-benzoic acid. |
| Q: What is the InChIKey of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid? |
| A: InChIKey of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid is KCBPUMJQOWGIER-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid? |
| A: Molecular weight of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid is 310.73100. |
| Q: What is the polar surface area (PSA) of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid? |
| A: Polar surface area (PSA) of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid is 54.37000. |
| Q: What is the English name of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid? |
| A: The English name of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid is 2-(1-chloronaphthalene-2-carbonyl)benzoic acid. |
| Q: What is the LogP of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid? |
| A: LogP of 2-(1-chloronaphthalene-2-carbonyl)benzoic acid is 4.42240. |