(4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone
Modify Date: 2025-10-05 20:41:35
(4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone structure
|
Common Name | (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 855609-58-4 | Molecular Weight | 271.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14ClNO |
|---|---|
| Molecular Weight | 271.74 |
| InChIKey | RQPNBUBLYHEGPS-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc2c(c1)CCCN2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone? |
| A: SMILES notation of (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone is O=C(c1ccc(Cl)cc1)c1ccc2c(c1)CCCN2. |
| Q: What is the Chinese name of 855609-58-4? |
| A: Chinese name of 855609-58-4 is O=C(c1ccc(Cl)cc1)c1ccc2c(c1)CCCN2. |
| Q: What is the InChIKey of (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone? |
| A: InChIKey of (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone is RQPNBUBLYHEGPS-UHFFFAOYSA-N. |
| Q: What is the English name of (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone? |
| A: The English name of (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone is (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone. |
| Q: What is the molecular weight of (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone? |
| A: Molecular weight of (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone is 271.74. |
| Q: What is the CAS number of (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone? |
| A: CAS number of (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone is 855609-58-4. |
| Q: What is the molecular formula of (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone? |
| A: Molecular formula of (4-Chlorophenyl)(1,2,3,4-tetrahydro-6-quinolinyl)methanone is C16H14ClNO. |