5-allyl-5-(2-cyclopenten-1-yl)barbituric acid, compound with [R-(R*,S*)]-α-[1-(methylamino)ethyl]benzenemethanol (1:1) structure
|
Common Name | 5-allyl-5-(2-cyclopenten-1-yl)barbituric acid, compound with [R-(R*,S*)]-α-[1-(methylamino)ethyl]benzenemethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 85567-52-8 | Molecular Weight | 399.48336 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H29N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-allyl-5-(2-cyclopenten-1-yl)barbituric acid, compound with [R-(R*,S*)]-alpha-[1-(methylamino)ethyl]benzenemethanol (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H29N3O4 |
|---|---|
| Molecular Weight | 399.48336 |
| InChIKey | RCBIKCQIGMRSPZ-CGUPRBNSSA-N |
| SMILES | C=CCC1(C2C=CCC2)C(=O)NC(=O)NC1=O.CNC(C)C(O)c1ccccc1 |
| EINECS 287-766-1 |