6-O-Trityl-1,2,3,4-tetra-O-benzoyl-β-D-glucopyranose
6-O-Trityl-1,2,3,4-tetra-O-benzoyl-β-D-glucopyranose structure
|
Common Name | 6-O-Trityl-1,2,3,4-tetra-O-benzoyl-β-D-glucopyranose | ||
|---|---|---|---|---|
| CAS Number | 85572-59-4 | Molecular Weight | 838.89500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C53H42O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1,2,3,4-Tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose (CAS: 85572-59-4, molecular formula: C53H42O10, molecular weight: 838.89500), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C53H42O10 |
|---|---|
| Molecular Weight | 838.89500 |
| Exact Mass | 838.27800 |
| PSA | 123.66000 |
| LogP | 9.25380 |
| InChIKey | CBFXEUSWGYYNPD-OVXZOCFZSA-N |
| SMILES | O=C(OC1OC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:104707-01-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-o-trityl-1,2,3,4-tetra-o-benzoyl-ss-d-glucopyranose |
| 6,8-dichloroflavone |
| 1,2,3,4-tetra-o-benzoyl-6-o-trityl-b-d-glucopyranose |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 85572-59-4? |
| A: Chinese name of 85572-59-4 is 85572-59-4. |
| Q: What is the SMILES notation of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose? |
| A: SMILES notation of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose is O=C(OC1OC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1. |
| Q: What is the molecular formula of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose? |
| A: Molecular formula of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose is C53H42O10. |
| Q: What is the polar surface area (PSA) of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose? |
| A: Polar surface area (PSA) of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose is 123.66000. |
| Q: What are the downstream products of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose? |
| A: Related downstream products(CAS) of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose: 104707-01-9. |
| Q: What is the LogP of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose? |
| A: LogP of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose is 9.25380. |
| Q: What is the InChIKey of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose? |
| A: InChIKey of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose is CBFXEUSWGYYNPD-OVXZOCFZSA-N. |
| Q: What English synonyms does 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose have? |
| A: English synonyms of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose: 6-o-trityl-1,2,3,4-tetra-o-benzoyl-ss-d-glucopyranose, 6,8-dichloroflavone, 1,2,3,4-tetra-o-benzoyl-6-o-trityl-b-d-glucopyranose. |
| Q: What is the English name of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose? |
| A: The English name of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose is 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose. |
| Q: What is the molecular weight of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose? |
| A: Molecular weight of 1,2,3,4-tetra-O-benzoyl-6-O-triphenylmethyl-β-D-glucopyranose is 838.89500. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |