7-Chloro-6H-dibenzo[b,d]pyran-6-one
Modify Date: 2026-07-25 12:00:49
![7-Chloro-6H-dibenzo[b,d]pyran-6-one Structure](https://www.chemsrc.com/extcaspic/079/855756-96-6.png)
7-Chloro-6H-dibenzo[b,d]pyran-6-one structure
|
Common Name | 7-Chloro-6H-dibenzo[b,d]pyran-6-one | ||
|---|---|---|---|---|
| CAS Number | 855756-96-6 | Molecular Weight | 230.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Chloro-6H-dibenzo[b,d]pyran-6-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H7ClO2 |
|---|---|
| Molecular Weight | 230.64 |
| InChIKey | CMVKZVLHJACFQN-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccccc2c2cccc(Cl)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 7-Chloro-6H-dibenzo[b,d]pyran-6-one? |
| A: Molecular weight of 7-Chloro-6H-dibenzo[b,d]pyran-6-one is 230.64. |
| Q: What is the SMILES notation of 7-Chloro-6H-dibenzo[b,d]pyran-6-one? |
| A: SMILES notation of 7-Chloro-6H-dibenzo[b,d]pyran-6-one is O=c1oc2ccccc2c2cccc(Cl)c12. |
| Q: What is the Chinese name of 855756-96-6? |
| A: Chinese name of 855756-96-6 is 855756-96-6. |
| Q: What is the InChIKey of 7-Chloro-6H-dibenzo[b,d]pyran-6-one? |
| A: InChIKey of 7-Chloro-6H-dibenzo[b,d]pyran-6-one is CMVKZVLHJACFQN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 7-Chloro-6H-dibenzo[b,d]pyran-6-one? |
| A: Molecular formula of 7-Chloro-6H-dibenzo[b,d]pyran-6-one is C13H7ClO2. |
| Q: What is the English name of 7-Chloro-6H-dibenzo[b,d]pyran-6-one? |
| A: The English name of 7-Chloro-6H-dibenzo[b,d]pyran-6-one is 7-Chloro-6H-dibenzo[b,d]pyran-6-one. |
| Q: What is the CAS number of 7-Chloro-6H-dibenzo[b,d]pyran-6-one? |
| A: CAS number of 7-Chloro-6H-dibenzo[b,d]pyran-6-one is 855756-96-6. |