Ethyl 2-methyl-6-quinolinecarboxylate structure
|
Common Name | Ethyl 2-methyl-6-quinolinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 855763-77-8 | Molecular Weight | 215.248 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 334.4±22.0 °C at 760 mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.1±22.3 °C | |
| Name | Ethyl 2-methylquinoline-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 334.4±22.0 °C at 760 mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.248 |
| Flash Point | 156.1±22.3 °C |
| Exact Mass | 215.094635 |
| PSA | 39.19000 |
| LogP | 3.10 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | WLKKUWXLOSMSMH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc2nc(C)ccc2c1 |
| HS Code | 2933499090 |
|---|
|
~%
Ethyl 2-methyl-... CAS#:855763-77-8 |
| Literature: Proceedings of the Royal Society of London, Series B: Biological Sciences, , vol. 110, p. 249,253 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Quinolinecarboxylic acid, 2-methyl-, ethyl ester |
| Ethyl 2-methyl-6-quinolinecarboxylate |
| Ethyl 2-methylquinoline-6-carboxylate |